C20H14N4O3 — CID 109164804
6-(1,3-benzodioxol-5-ylamino)-N-(4-cyanophenyl)pyridine-3-carboxamide (PubChem CID 109164804) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylamino)-N-(4-cyanophenyl)pyridine-3-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylamino)-N-(4-cyanophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164804 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylamino)-N-(4-cyanophenyl)pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(Nc3ccc4c(c3)OCO4)nc2)cc1 |
| InChI | InChI=1S/C20H14N4O3/c21-10-13-1-4-15(5-2-13)24-20(25)14-3-8-19(22-11-14)23-16-6-7-17-18(9-16)27-12-26-17/h1-9,11H,12H2,(H,22,23)(H,24,25) |
| InChIKey | CZBXAGCHKVLHPE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |