C21H17N3O4 — CID 109164518
N-(4-acetylphenyl)-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxamide (PubChem CID 109164518) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-(4-acetylphenyl)-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164518 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(4-acetylphenyl)-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(Nc3ccc4c(c3)OCO4)nc2)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-13(25)14-2-5-16(6-3-14)24-21(26)15-4-9-20(22-11-15)23-17-7-8-18-19(10-17)28-12-27-18/h2-11H,12H2,1H3,(H,22,23)(H,24,26) |
| InChIKey | ILJYEHMCWLTNFW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |