C20H16ClN3O3 — CID 109163587
N-(1,3-benzodioxol-5-yl)-6-(5-chloro-2-methylanilino)pyridine-3-carboxamide (PubChem CID 109163587) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(5-chloro-2-methylanilino)pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(5-chloro-2-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109163587 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(5-chloro-2-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Cl)cc1Nc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C20H16ClN3O3/c1-12-2-4-14(21)8-16(12)24-19-7-3-13(10-22-19)20(25)23-15-5-6-17-18(9-15)27-11-26-17/h2-10H,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ODKZKKPEARTUPO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |