C12H9N5O3 — CID 146158017
1-(2-amino-1,2-dicyanoethenyl)-3-(1,3-benzodioxol-5-yl)urea (PubChem CID 146158017) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-(2-amino-1,2-dicyanoethenyl)-3-(1,3-benzodioxol-5-yl)urea.
| Compound Name | 1-(2-amino-1,2-dicyanoethenyl)-3-(1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 146158017 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(2-amino-1,2-dicyanoethenyl)-3-(1,3-benzodioxol-5-yl)urea |
| SMILES | N#CC(N)=C(C#N)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H9N5O3/c13-4-8(15)9(5-14)17-12(18)16-7-1-2-10-11(3-7)20-6-19-10/h1-3H,6,15H2,(H2,16,17,18) |
| InChIKey | BMCGDVNOKYRKDV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|