C9H9N3O4 — CID 4774594
N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide (PubChem CID 4774594) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 4774594 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide |
| SMILES | NNC(=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9N3O4/c10-12-9(14)8(13)11-5-1-2-6-7(3-5)16-4-15-6/h1-3H,4,10H2,(H,11,13)(H,12,14) |
| InChIKey | AYYFRBPVEVPCIA-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|