C15H17N3O5 — CID 108531851
N-(1,3-benzodioxol-5-yl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108531851) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108531851 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H17N3O5/c19-13(9-3-5-16-6-4-9)18-15(21)14(20)17-10-1-2-11-12(7-10)23-8-22-11/h1-2,7,9,16H,3-6,8H2,(H,17,20)(H,18,19,21) |
| InChIKey | HMBCPAYGUUTFHY-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|