C15H18N4O4 — CID 108530454
N-(4-carbamoylphenyl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108530454) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(4-carbamoylphenyl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108530454 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(4-carbamoylphenyl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)NC(=O)C2CCNCC2)cc1 |
| InChI | InChI=1S/C15H18N4O4/c16-12(20)9-1-3-11(4-2-9)18-14(22)15(23)19-13(21)10-5-7-17-8-6-10/h1-4,10,17H,5-8H2,(H2,16,20)(H,18,22)(H,19,21,23) |
| InChIKey | RRRKZPXJEDJXIG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|