C14H15ClFN3O3 — CID 108530544
N-(3-chloro-4-fluorophenyl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108530544) has the molecular formula C14H15ClFN3O3 and a molecular weight of 327.74 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108530544 |
| Molecular Formula | C14H15ClFN3O3 |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClFN3O3/c15-10-7-9(1-2-11(10)16)18-13(21)14(22)19-12(20)8-3-5-17-6-4-8/h1-2,7-8,17H,3-6H2,(H,18,21)(H,19,20,22) |
| InChIKey | ILENNFXRMWKYCE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|