C15H9ClF4N2O2 — CID 108530569
N'-(3-chloro-4-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 108530569) has the molecular formula C15H9ClF4N2O2 and a molecular weight of 360.69 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108530569 |
| Molecular Formula | C15H9ClF4N2O2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClF4N2O2/c16-11-7-10(5-6-12(11)17)22-14(24)13(23)21-9-3-1-8(2-4-9)15(18,19)20/h1-7H,(H,21,23)(H,22,24) |
| InChIKey | OYGLGAYFZJSOMS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|