C10H10ClFN2O3 — CID 7585032
N'-(3-chloro-4-fluorophenyl)-N-(2-hydroxyethyl)oxamide (PubChem CID 7585032) has the molecular formula C10H10ClFN2O3 and a molecular weight of 260.65 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 7585032 |
| Molecular Formula | C10H10ClFN2O3 |
| Molecular Weight | 260.65 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-(2-hydroxyethyl)oxamide |
| SMILES | O=C(NCCO)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClFN2O3/c11-7-5-6(1-2-8(7)12)14-10(17)9(16)13-3-4-15/h1-2,5,15H,3-4H2,(H,13,16)(H,14,17) |
| InChIKey | GQONNGACBBWLAZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.65 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|