C15H20ClFN2O3 — CID 90523603
N'-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide (PubChem CID 90523603) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 90523603 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide |
| SMILES | CC(C)(C)C(O)CCNC(=O)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClFN2O3/c1-15(2,3)12(20)6-7-18-13(21)14(22)19-9-4-5-11(17)10(16)8-9/h4-5,8,12,20H,6-7H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | JENAUYSUYGFEEP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|