C16H22N2O5 — CID 90523588
N'-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide (PubChem CID 90523588) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 90523588 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-4,4-dimethylpentyl)oxamide |
| SMILES | CC(C)(C)C(O)CCNC(=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O5/c1-16(2,3)13(19)6-7-17-14(20)15(21)18-10-4-5-11-12(8-10)23-9-22-11/h4-5,8,13,19H,6-7,9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | ZUHICRMUGJEFRH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|