C16H16N2O6 — CID 90523924
N'-(1,3-benzodioxol-5-yl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide (PubChem CID 90523924) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 90523924 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
| SMILES | O=C(NCCC(O)c1ccco1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N2O6/c19-11(12-2-1-7-22-12)5-6-17-15(20)16(21)18-10-3-4-13-14(8-10)24-9-23-13/h1-4,7-8,11,19H,5-6,9H2,(H,17,20)(H,18,21) |
| InChIKey | SFKQZXTVNXEBFN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|