C14H21ClN2O2 — CID 90523643
1-(4-chlorophenyl)-3-(3-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 90523643) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(3-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 90523643 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CC(C)(C)C(O)CCNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-14(2,3)12(18)8-9-16-13(19)17-11-6-4-10(15)5-7-11/h4-7,12,18H,8-9H2,1-3H3,(H2,16,17,19) |
| InChIKey | VVUFXNXFRIPVOC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |