C19H22Cl2N4O2 — CID 40625211
1-(4-chlorophenyl)-3-[(3R)-1-[(4-chlorophenyl)carbamoylamino]pentan-3-yl]urea (PubChem CID 40625211) has the molecular formula C19H22Cl2N4O2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3R)-1-[(4-chlorophenyl)carbamoylamino]pentan-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3R)-1-[(4-chlorophenyl)carbamoylamino]pentan-3-yl]urea |
|---|---|
| PubChem CID | 40625211 |
| Molecular Formula | C19H22Cl2N4O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3R)-1-[(4-chlorophenyl)carbamoylamino]pentan-3-yl]urea |
| SMILES | CC[C@H](CCNC(=O)Nc1ccc(Cl)cc1)NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N4O2/c1-2-15(23-19(27)25-17-9-5-14(21)6-10-17)11-12-22-18(26)24-16-7-3-13(20)4-8-16/h3-10,15H,2,11-12H2,1H3,(H2,22,24,26)(H2,23,25,27)/t15-/m1/s1 |
| InChIKey | NPBCKYMQGUSKSZ-OAHLLOKOSA-N |
| XLogP | 5.11 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |