C14H19ClN2O3 — CID 7645627
methyl (2R,3S)-2-[(4-chlorophenyl)carbamoylamino]-3-methylpentanoate (PubChem CID 7645627) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is methyl (2R,3S)-2-[(4-chlorophenyl)carbamoylamino]-3-methylpentanoate.
| Compound Name | methyl (2R,3S)-2-[(4-chlorophenyl)carbamoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 7645627 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl (2R,3S)-2-[(4-chlorophenyl)carbamoylamino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)Nc1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C14H19ClN2O3/c1-4-9(2)12(13(18)20-3)17-14(19)16-11-7-5-10(15)6-8-11/h5-9,12H,4H2,1-3H3,(H2,16,17,19)/t9-,12+/m0/s1 |
| InChIKey | WZQZBHVSIQVKJE-JOYOIKCWSA-N |
| XLogP | 3.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |