C20H31ClN4O3 — CID 4906658
methyl 2-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamoylamino]-3-methylpentanoate (PubChem CID 4906658) has the molecular formula C20H31ClN4O3 and a molecular weight of 410.95 g/mol. Its IUPAC name is methyl 2-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamoylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 4906658 |
| Molecular Formula | C20H31ClN4O3 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 2-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamoylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)Nc1ccc(N2CCN(CC)CC2)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C20H31ClN4O3/c1-5-14(3)18(19(26)28-4)23-20(27)22-15-7-8-17(16(21)13-15)25-11-9-24(6-2)10-12-25/h7-8,13-14,18H,5-6,9-12H2,1-4H3,(H2,22,23,27) |
| InChIKey | QVJSUFYWJZALTJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|