C22H28ClN3O2 — CID 110167007
N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2-hydroxy-5-propan-2-ylbenzamide (PubChem CID 110167007) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2-hydroxy-5-propan-2-ylbenzamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2-hydroxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 110167007 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2-hydroxy-5-propan-2-ylbenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc(C(C)C)ccc3O)cc2Cl)CC1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-4-25-9-11-26(12-10-25)20-7-6-17(14-19(20)23)24-22(28)18-13-16(15(2)3)5-8-21(18)27/h5-8,13-15,27H,4,9-12H2,1-3H3,(H,24,28) |
| InChIKey | XVZSHCPVSHNXSM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|