C24H31ClN4OS — CID 3991845
4-tert-butyl-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3991845) has the molecular formula C24H31ClN4OS and a molecular weight of 459.06 g/mol. Its IUPAC name is 4-tert-butyl-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3991845 |
| Molecular Formula | C24H31ClN4OS |
| Molecular Weight | 459.06 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-tert-butyl-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)c3ccc(C(C)(C)C)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C24H31ClN4OS/c1-5-28-12-14-29(15-13-28)21-11-10-19(16-20(21)25)26-23(31)27-22(30)17-6-8-18(9-7-17)24(2,3)4/h6-11,16H,5,12-15H2,1-4H3,(H2,26,27,30,31) |
| InChIKey | OFYNQNFKDNREKO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.06 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|