C17H25ClN4OS — CID 1395560
N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 1395560) has the molecular formula C17H25ClN4OS and a molecular weight of 368.93 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1395560 |
| Molecular Formula | C17H25ClN4OS |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)C(C)C)cc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN4OS/c1-4-21-7-9-22(10-8-21)15-6-5-13(11-14(15)18)19-17(24)20-16(23)12(2)3/h5-6,11-12H,4,7-10H2,1-3H3,(H2,19,20,23,24) |
| InChIKey | APHVYDALNSYTTO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|