C19H17ClF5N3O — CID 46830361
N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 46830361) has the molecular formula C19H17ClF5N3O and a molecular weight of 433.81 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 46830361 |
| Molecular Formula | C19H17ClF5N3O |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H17ClF5N3O/c1-2-27-5-7-28(8-6-27)12-4-3-10(9-11(12)20)26-19(29)13-14(21)16(23)18(25)17(24)15(13)22/h3-4,9H,2,5-8H2,1H3,(H,26,29) |
| InChIKey | QKFHNOPORKWPCI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|