C19H12ClF8N3O2 — CID 43913412
N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 43913412) has the molecular formula C19H12ClF8N3O2 and a molecular weight of 501.76 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 43913412 |
| Molecular Formula | C19H12ClF8N3O2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)c(Cl)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H12ClF8N3O2/c20-9-7-8(29-17(32)11-12(21)14(23)16(25)15(24)13(11)22)1-2-10(9)30-3-5-31(6-4-30)18(33)19(26,27)28/h1-2,7H,3-6H2,(H,29,32) |
| InChIKey | YYMDWXCIRFDIFQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|