C22H20ClF3N4O4S — CID 43914143
N-[[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 43914143) has the molecular formula C22H20ClF3N4O4S and a molecular weight of 528.94 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 43914143 |
| Molecular Formula | C22H20ClF3N4O4S |
| Molecular Weight | 528.94 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | N-[[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)c(Cl)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H20ClF3N4O4S/c23-15-12-14(2-3-16(15)29-5-7-30(8-6-29)20(32)22(24,25)26)27-21(35)28-19(31)13-1-4-17-18(11-13)34-10-9-33-17/h1-4,11-12H,5-10H2,(H2,27,28,31,35) |
| InChIKey | LSYOWLUJJJNZFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.94 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|