C17H14N2O5S — CID 17099467
3-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid (PubChem CID 17099467) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 17099467 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=S)NC(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H14N2O5S/c20-15(10-4-5-13-14(9-10)24-7-6-23-13)19-17(25)18-12-3-1-2-11(8-12)16(21)22/h1-5,8-9H,6-7H2,(H,21,22)(H2,18,19,20,25) |
| InChIKey | FJYVHXNIPSBFJD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|