C23H19N3O4S — CID 2978640
N-[(3-benzamidophenyl)carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 2978640) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[(3-benzamidophenyl)carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(3-benzamidophenyl)carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 2978640 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(3-benzamidophenyl)carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(NC(=O)c2ccccc2)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H19N3O4S/c27-21(15-5-2-1-3-6-15)24-17-7-4-8-18(14-17)25-23(31)26-22(28)16-9-10-19-20(13-16)30-12-11-29-19/h1-10,13-14H,11-12H2,(H,24,27)(H2,25,26,28,31) |
| InChIKey | NKRSDBSQFNLKHY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|