C15H14N2O2S — CID 4591472
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylthiourea (PubChem CID 4591472) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylthiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 4591472 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H14N2O2S/c20-15(16-11-4-2-1-3-5-11)17-12-6-7-13-14(10-12)19-9-8-18-13/h1-7,10H,8-9H2,(H2,16,17,20) |
| InChIKey | PAMFMUDNDFOWJT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|