C9H11N3O2S — CID 2731589
1-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea (PubChem CID 2731589) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea.
| Compound Name | 1-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
|---|---|
| PubChem CID | 2731589 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
| SMILES | NNC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H11N3O2S/c10-12-9(15)11-6-1-2-7-8(5-6)14-4-3-13-7/h1-2,5H,3-4,10H2,(H2,11,12,15) |
| InChIKey | ZJONWBIJODOQIU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|