C12H15N3O3S — CID 17375583
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(propanoylamino)thiourea (PubChem CID 17375583) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(propanoylamino)thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(propanoylamino)thiourea |
|---|---|
| PubChem CID | 17375583 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(propanoylamino)thiourea |
| SMILES | CCC(=O)NNC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-11(16)14-15-12(19)13-8-3-4-9-10(7-8)18-6-5-17-9/h3-4,7H,2,5-6H2,1H3,(H,14,16)(H2,13,15,19) |
| InChIKey | WAMLXTCWFVAZHG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|