C19H20ClN3O4S — CID 27525747
1-[[(2R)-2-(3-chlorophenoxy)butanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea (PubChem CID 27525747) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 1-[[(2R)-2-(3-chlorophenoxy)butanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea.
| Compound Name | 1-[[(2R)-2-(3-chlorophenoxy)butanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
|---|---|
| PubChem CID | 27525747 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 1-[[(2R)-2-(3-chlorophenoxy)butanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)NNC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-2-15(27-14-5-3-4-12(20)10-14)18(24)22-23-19(28)21-13-6-7-16-17(11-13)26-9-8-25-16/h3-7,10-11,15H,2,8-9H2,1H3,(H,22,24)(H2,21,23,28)/t15-/m1/s1 |
| InChIKey | HALJZAHYPCBLHR-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|