C18H17ClFN3O4S — CID 27526133
1-[[(2S)-2-(2-chloro-4-fluorophenoxy)propanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea (PubChem CID 27526133) has the molecular formula C18H17ClFN3O4S and a molecular weight of 425.87 g/mol. Its IUPAC name is 1-[[(2S)-2-(2-chloro-4-fluorophenoxy)propanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea.
| Compound Name | 1-[[(2S)-2-(2-chloro-4-fluorophenoxy)propanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
|---|---|
| PubChem CID | 27526133 |
| Molecular Formula | C18H17ClFN3O4S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-[[(2S)-2-(2-chloro-4-fluorophenoxy)propanoyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
| SMILES | C[C@H](Oc1ccc(F)cc1Cl)C(=O)NNC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17ClFN3O4S/c1-10(27-14-4-2-11(20)8-13(14)19)17(24)22-23-18(28)21-12-3-5-15-16(9-12)26-7-6-25-15/h2-5,8-10H,6-7H2,1H3,(H,22,24)(H2,21,23,28)/t10-/m0/s1 |
| InChIKey | SZPODJFVLIAZEF-JTQLQIEISA-N |
| XLogP | 3.04 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|