C17H15Cl2NO3 — CID 42951852
2-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1-benzofuran-5-yl)propanamide (PubChem CID 42951852) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1-benzofuran-5-yl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1-benzofuran-5-yl)propanamide |
|---|---|
| PubChem CID | 42951852 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1-benzofuran-5-yl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H15Cl2NO3/c1-10(23-16-4-2-12(18)9-14(16)19)17(21)20-13-3-5-15-11(8-13)6-7-22-15/h2-5,8-10H,6-7H2,1H3,(H,20,21) |
| InChIKey | IPYTXAZYGXDDKZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |