C15H12BrFN2O2S — CID 46924188
1-(4-bromo-2-fluorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea (PubChem CID 46924188) has the molecular formula C15H12BrFN2O2S and a molecular weight of 383.24 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
|---|---|
| PubChem CID | 46924188 |
| Molecular Formula | C15H12BrFN2O2S |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
| SMILES | Fc1cc(Br)ccc1NC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H12BrFN2O2S/c16-9-1-3-12(11(17)7-9)19-15(22)18-10-2-4-13-14(8-10)21-6-5-20-13/h1-4,7-8H,5-6H2,(H2,18,19,22) |
| InChIKey | JKIGMPXYTCWBIT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|