C15H15BrFN3O2S2 — CID 46800340
1-(4-bromo-2-fluorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 46800340) has the molecular formula C15H15BrFN3O2S2 and a molecular weight of 432.34 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 46800340 |
| Molecular Formula | C15H15BrFN3O2S2 |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)Nc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C15H15BrFN3O2S2/c1-20(2)24(21,22)12-5-3-4-11(9-12)18-15(23)19-14-7-6-10(16)8-13(14)17/h3-9H,1-2H3,(H2,18,19,23) |
| InChIKey | RCZOKUPQQNDONE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|