C13H21N3O2S2 — CID 8619665
1-[(2R)-butan-2-yl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 8619665) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 8619665 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CC[C@@H](C)NC(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-5-10(2)14-13(19)15-11-7-6-8-12(9-11)20(17,18)16(3)4/h6-10H,5H2,1-4H3,(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | XOOOWINOKNBQFA-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|