C15H19N3O2S3 — CID 8658083
1-[3-(dimethylsulfamoyl)phenyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea (PubChem CID 8658083) has the molecular formula C15H19N3O2S3 and a molecular weight of 369.54 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8658083 |
| Molecular Formula | C15H19N3O2S3 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1cccc(S(=O)(=O)N(C)C)c1)c1cccs1 |
| InChI | InChI=1S/C15H19N3O2S3/c1-11(14-8-5-9-22-14)16-15(21)17-12-6-4-7-13(10-12)23(19,20)18(2)3/h4-11H,1-3H3,(H2,16,17,21)/t11-/m0/s1 |
| InChIKey | XJIQLZWLZVVGND-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|