C13H21N3O3S2 — CID 7765713
1-[3-(dimethylsulfamoyl)phenyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea (PubChem CID 7765713) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea |
|---|---|
| PubChem CID | 7765713 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea |
| SMILES | CC[C@H](CO)NC(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H21N3O3S2/c1-4-10(9-17)14-13(20)15-11-6-5-7-12(8-11)21(18,19)16(2)3/h5-8,10,17H,4,9H2,1-3H3,(H2,14,15,20)/t10-/m1/s1 |
| InChIKey | WPAZLDKSVUAVFP-SNVBAGLBSA-N |
| XLogP | 0.99 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|