C17H29N3O2S2 — CID 8624419
1,1-dibutyl-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 8624419) has the molecular formula C17H29N3O2S2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 1,1-dibutyl-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1,1-dibutyl-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 8624419 |
| Molecular Formula | C17H29N3O2S2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1,1-dibutyl-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CCCCN(CCCC)C(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H29N3O2S2/c1-5-7-12-20(13-8-6-2)17(23)18-15-10-9-11-16(14-15)24(21,22)19(3)4/h9-11,14H,5-8,12-13H2,1-4H3,(H,18,23) |
| InChIKey | PQXAHEMKTQGCKE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|