C23H25N3O2S2 — CID 42994753
1-benzhydryl-3-[3-(dimethylsulfamoyl)phenyl]-1-methylthiourea (PubChem CID 42994753) has the molecular formula C23H25N3O2S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 1-benzhydryl-3-[3-(dimethylsulfamoyl)phenyl]-1-methylthiourea.
| Compound Name | 1-benzhydryl-3-[3-(dimethylsulfamoyl)phenyl]-1-methylthiourea |
|---|---|
| PubChem CID | 42994753 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-benzhydryl-3-[3-(dimethylsulfamoyl)phenyl]-1-methylthiourea |
| SMILES | CN(C(=S)Nc1cccc(S(=O)(=O)N(C)C)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O2S2/c1-25(2)30(27,28)21-16-10-15-20(17-21)24-23(29)26(3)22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-17,22H,1-3H3,(H,24,29) |
| InChIKey | HEOFMVHQMCXAGR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|