C24H27N3O3S — CID 52592042
1-[3-(dimethylsulfamoyl)phenyl]-3-(3,3-diphenylpropyl)urea (PubChem CID 52592042) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,3-diphenylpropyl)urea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 52592042 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,3-diphenylpropyl)urea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)NCCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-27(2)31(29,30)22-15-9-14-21(18-22)26-24(28)25-17-16-23(19-10-5-3-6-11-19)20-12-7-4-8-13-20/h3-15,18,23H,16-17H2,1-2H3,(H2,25,26,28) |
| InChIKey | ADWXRUOPZKTYFB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |