C13H22ClN3O3S — CID 119672946
N-[3-(dimethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119672946) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119672946 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C13H21N3O3S.ClH/c1-10(9-14-2)13(17)15-11-6-5-7-12(8-11)20(18,19)16(3)4;/h5-8,10,14H,9H2,1-4H3,(H,15,17);1H |
| InChIKey | UQANPFPLQLCRMM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |