C12H19ClN4O2 — CID 119702019
N-[3-(carbamoylamino)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119702019) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-[3-(carbamoylamino)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119702019 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cccc(NC(N)=O)c1.Cl |
| InChI | InChI=1S/C12H18N4O2.ClH/c1-8(7-14-2)11(17)15-9-4-3-5-10(6-9)16-12(13)18;/h3-6,8,14H,7H2,1-2H3,(H,15,17)(H3,13,16,18);1H |
| InChIKey | JHENYYOIFODJQB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |