C15H17N3O4S — CID 122150681
1-[3-(dimethylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)urea (PubChem CID 122150681) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 122150681 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(4-hydroxyphenyl)urea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)Nc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-18(2)23(21,22)14-5-3-4-12(10-14)17-15(20)16-11-6-8-13(19)9-7-11/h3-10,19H,1-2H3,(H2,16,17,20) |
| InChIKey | SFYOYKWVBGIJLW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|