C22H33N3O3S — CID 3599813
1-[3-(dimethylsulfamoyl)phenyl]-3-(3,5,7-trimethyl-1-adamantyl)urea (PubChem CID 3599813) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,5,7-trimethyl-1-adamantyl)urea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,5,7-trimethyl-1-adamantyl)urea |
|---|---|
| PubChem CID | 3599813 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3,5,7-trimethyl-1-adamantyl)urea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)NC23CC4(C)CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H33N3O3S/c1-19-10-20(2)12-21(3,11-19)15-22(13-19,14-20)24-18(26)23-16-7-6-8-17(9-16)29(27,28)25(4)5/h6-9H,10-15H2,1-5H3,(H2,23,24,26) |
| InChIKey | YGUOZHZZPLBIHR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |