C16H23ClN6O3S — CID 119672920
N-[3-(dimethylsulfamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119672920) has the molecular formula C16H23ClN6O3S and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119672920 |
| Molecular Formula | C16H23ClN6O3S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C16H22N6O3S.ClH/c1-21(2)26(24,25)14-5-3-4-12(10-14)18-16(23)15-11-22(20-19-15)13-6-8-17-9-7-13;/h3-5,10-11,13,17H,6-9H2,1-2H3,(H,18,23);1H |
| InChIKey | OBHAAQRXDSFRRL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |