C15H16F3N5O — CID 119671254
1-piperidin-4-yl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 119671254) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119671254 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-piperidin-4-yl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C15H16F3N5O/c16-15(17,18)10-2-1-3-11(8-10)20-14(24)13-9-23(22-21-13)12-4-6-19-7-5-12/h1-3,8-9,12,19H,4-7H2,(H,20,24) |
| InChIKey | YHPMRHGDXOGNIH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |