C19H22F3N5O — CID 119806404
1-piperidin-4-yl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]triazole-4-carboxamide (PubChem CID 119806404) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119806404 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-piperidin-4-yl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]triazole-4-carboxamide |
| SMILES | O=C(NC1(c2cccc(C(F)(F)F)c2)CCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H22F3N5O/c20-19(21,22)14-4-1-3-13(11-14)18(7-2-8-18)24-17(28)16-12-27(26-25-16)15-5-9-23-10-6-15/h1,3-4,11-12,15,23H,2,5-10H2,(H,24,28) |
| InChIKey | WTKRQWCGBNOZLR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |