C19H24F3N5O — CID 119771408
N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119771408) has the molecular formula C19H24F3N5O and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119771408 |
| Molecular Formula | C19H24F3N5O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CC(C)(CNC(=O)c1cn(C2CCNCC2)nn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N5O/c1-18(2,13-4-3-5-14(10-13)19(20,21)22)12-24-17(28)16-11-27(26-25-16)15-6-8-23-9-7-15/h3-5,10-11,15,23H,6-9,12H2,1-2H3,(H,24,28) |
| InChIKey | CBIKFCKYJZBMCI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |