C11H15N5O — CID 63283381
1-piperidin-4-yl-N-prop-2-ynyltriazole-4-carboxamide (PubChem CID 63283381) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-prop-2-ynyltriazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-prop-2-ynyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 63283381 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 1-piperidin-4-yl-N-prop-2-ynyltriazole-4-carboxamide |
| SMILES | C#CCNC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C11H15N5O/c1-2-5-13-11(17)10-8-16(15-14-10)9-3-6-12-7-4-9/h1,8-9,12H,3-7H2,(H,13,17) |
| InChIKey | QUNHRIIPRLJFNE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|