C12H22ClN5O2 — CID 75373004
N-(3-hydroxybutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 75373004) has the molecular formula C12H22ClN5O2 and a molecular weight of 303.79 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-hydroxybutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 75373004 |
| Molecular Formula | C12H22ClN5O2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-(3-hydroxybutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CC(O)CCNC(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C12H21N5O2.ClH/c1-9(18)2-7-14-12(19)11-8-17(16-15-11)10-3-5-13-6-4-10;/h8-10,13,18H,2-7H2,1H3,(H,14,19);1H |
| InChIKey | YTUIPWJYTIQWLD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |