C15H28Cl2N6O — CID 119835561
1-piperidin-4-yl-N-(3-pyrrolidin-1-ylpropyl)triazole-4-carboxamide;dihydrochloride (PubChem CID 119835561) has the molecular formula C15H28Cl2N6O and a molecular weight of 379.34 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(3-pyrrolidin-1-ylpropyl)triazole-4-carboxamide;dihydrochloride.
| Compound Name | 1-piperidin-4-yl-N-(3-pyrrolidin-1-ylpropyl)triazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119835561 |
| Molecular Formula | C15H28Cl2N6O |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-piperidin-4-yl-N-(3-pyrrolidin-1-ylpropyl)triazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C15H26N6O.2ClH/c22-15(17-6-3-11-20-9-1-2-10-20)14-12-21(19-18-14)13-4-7-16-8-5-13;;/h12-13,16H,1-11H2,(H,17,22);2*1H |
| InChIKey | MOADAFZWCVWBHE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|